C22H20ClF3N4O3 — CID 46884918
1-(4-chlorophenyl)-N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 46884918) has the molecular formula C22H20ClF3N4O3 and a molecular weight of 480.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46884918 |
| Molecular Formula | C22H20ClF3N4O3 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[(4-ethoxybenzoyl)amino]ethyl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCCNC(=O)c2cn(-c3ccc(Cl)cc3)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20ClF3N4O3/c1-2-33-17-9-3-14(4-10-17)20(31)27-11-12-28-21(32)18-13-30(29-19(18)22(24,25)26)16-7-5-15(23)6-8-16/h3-10,13H,2,11-12H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | NJZJNSBOGYALCY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|