C24H25F3N4O4 — CID 46884919
N-[2-[(4-ethoxybenzoyl)amino]ethyl]-1-(4-ethoxyphenyl)-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 46884919) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is N-[2-[(4-ethoxybenzoyl)amino]ethyl]-1-(4-ethoxyphenyl)-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-[(4-ethoxybenzoyl)amino]ethyl]-1-(4-ethoxyphenyl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46884919 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[2-[(4-ethoxybenzoyl)amino]ethyl]-1-(4-ethoxyphenyl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCCNC(=O)c2cn(-c3ccc(OCC)cc3)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F3N4O4/c1-3-34-18-9-5-16(6-10-18)22(32)28-13-14-29-23(33)20-15-31(30-21(20)24(25,26)27)17-7-11-19(12-8-17)35-4-2/h5-12,15H,3-4,13-14H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | UVUUSQBAQOGVDC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|