C9H7Br2NO — CID 117209434
4,5-dibromo-1-methyl-3H-indol-2-one (PubChem CID 117209434) has the molecular formula C9H7Br2NO and a molecular weight of 304.97 g/mol. Its IUPAC name is 4,5-dibromo-1-methyl-3H-indol-2-one.
| Compound Name | 4,5-dibromo-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 117209434 |
| Molecular Formula | C9H7Br2NO |
| Molecular Weight | 304.97 g/mol |
| Exact Mass | 302.89 |
| IUPAC Name | 4,5-dibromo-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2c1ccc(Br)c2Br |
| InChI | InChI=1S/C9H7Br2NO/c1-12-7-3-2-6(10)9(11)5(7)4-8(12)13/h2-3H,4H2,1H3 |
| InChIKey | XHSGOXFSQHLIJX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.97 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |