C10H9Br2NO — CID 117209554
5,6-dibromo-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 117209554) has the molecular formula C10H9Br2NO and a molecular weight of 319.00 g/mol. Its IUPAC name is 5,6-dibromo-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 5,6-dibromo-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 117209554 |
| Molecular Formula | C10H9Br2NO |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.91 |
| IUPAC Name | 5,6-dibromo-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2c1ccc(Br)c2Br |
| InChI | InChI=1S/C10H9Br2NO/c1-13-8-4-3-7(11)10(12)6(8)2-5-9(13)14/h3-4H,2,5H2,1H3 |
| InChIKey | SJLSNDQIQLLLNV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |