C11H11F3N2O — CID 117209532
6-amino-1-methyl-5-(trifluoromethyl)-3,4-dihydroquinolin-2-one (PubChem CID 117209532) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 6-amino-1-methyl-5-(trifluoromethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-methyl-5-(trifluoromethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 117209532 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 6-amino-1-methyl-5-(trifluoromethyl)-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2c1ccc(N)c2C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c1-16-8-4-3-7(15)10(11(12,13)14)6(8)2-5-9(16)17/h3-4H,2,5,15H2,1H3 |
| InChIKey | DIXZZBKKPQBXSV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|