C10H9NO4 — CID 117209495
6-hydroxy-1-methyl-2-oxo-3H-indole-5-carboxylic acid (PubChem CID 117209495) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 6-hydroxy-1-methyl-2-oxo-3H-indole-5-carboxylic acid.
| Compound Name | 6-hydroxy-1-methyl-2-oxo-3H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 117209495 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 6-hydroxy-1-methyl-2-oxo-3H-indole-5-carboxylic acid |
| SMILES | CN1C(=O)Cc2cc(C(=O)O)c(O)cc21 |
| InChI | InChI=1S/C10H9NO4/c1-11-7-4-8(12)6(10(14)15)2-5(7)3-9(11)13/h2,4,12H,3H2,1H3,(H,14,15) |
| InChIKey | LUTFTBVEJNVXSU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |