C14H11NO3S — CID 82488719
4-(1-methyl-2-oxo-3H-indol-5-yl)thiophene-3-carboxylic acid (PubChem CID 82488719) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-(1-methyl-2-oxo-3H-indol-5-yl)thiophene-3-carboxylic acid.
| Compound Name | 4-(1-methyl-2-oxo-3H-indol-5-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 82488719 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-(1-methyl-2-oxo-3H-indol-5-yl)thiophene-3-carboxylic acid |
| SMILES | CN1C(=O)Cc2cc(-c3cscc3C(=O)O)ccc21 |
| InChI | InChI=1S/C14H11NO3S/c1-15-12-3-2-8(4-9(12)5-13(15)16)10-6-19-7-11(10)14(17)18/h2-4,6-7H,5H2,1H3,(H,17,18) |
| InChIKey | ZTWIIFPGCPIVMN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |