C14H12O2S — CID 82130354
4-(2,3-dihydro-1H-inden-5-yl)thiophene-3-carboxylic acid (PubChem CID 82130354) has the molecular formula C14H12O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)thiophene-3-carboxylic acid.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 82130354 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1cscc1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H12O2S/c15-14(16)13-8-17-7-12(13)11-5-4-9-2-1-3-10(9)6-11/h4-8H,1-3H2,(H,15,16) |
| InChIKey | BFFKSENKOQRGAI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |