4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid

C13H10N2O4 — CID 82300289

IUPAC4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid
SMILESCN1C(=O)Cc2cc(-c3ncoc3C(=O)O)ccc21
InChIInChI=1S/C13H10N2O4/c1-15-9-3-2-7(4-8(9)5-10(15)16)11-12(13(17)18)19-6-14-11/h2-4,6H,5H2,1H3,(H,17,18)
InChIKeyCICCQUMWQOOEQD-UHFFFAOYSA-N
MW258.23 g/mol
LogP1.56
Rot. Bonds2

About 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid

4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 82300289) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid
PubChem CID82300289
Molecular FormulaC13H10N2O4
Molecular Weight258.23 g/mol
Exact Mass258.06
IUPAC Name4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid
SMILESCN1C(=O)Cc2cc(-c3ncoc3C(=O)O)ccc21
InChIInChI=1S/C13H10N2O4/c1-15-9-3-2-7(4-8(9)5-10(15)16)11-12(13(17)18)19-6-14-11/h2-4,6H,5H2,1H3,(H,17,18)
InChIKeyCICCQUMWQOOEQD-UHFFFAOYSA-N
XLogP1.56
TPSA83.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.23
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid (CID 82300289) is 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid is CN1C(=O)Cc2cc(-c3ncoc3C(=O)O)ccc21.
What is the InChIKey of 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is CICCQUMWQOOEQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4/c1-15-9-3-2-7(4-8(9)5-10(15)16)11-12(13(17)18)19-6-14-11/h2-4,6H,5H2,1H3,(H,17,18).
What are the key properties of 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid?
4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 258.23 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methyl-2-oxo-3H-indol-5-yl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 82300289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).