C16H15N3O3 — CID 82308194
3-(1-methyl-2-oxo-3H-indol-5-yl)-1-prop-2-enylpyrazole-5-carboxylic acid (PubChem CID 82308194) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-(1-methyl-2-oxo-3H-indol-5-yl)-1-prop-2-enylpyrazole-5-carboxylic acid.
| Compound Name | 3-(1-methyl-2-oxo-3H-indol-5-yl)-1-prop-2-enylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82308194 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-(1-methyl-2-oxo-3H-indol-5-yl)-1-prop-2-enylpyrazole-5-carboxylic acid |
| SMILES | C=CCn1nc(-c2ccc3c(c2)CC(=O)N3C)cc1C(=O)O |
| InChI | InChI=1S/C16H15N3O3/c1-3-6-19-14(16(21)22)9-12(17-19)10-4-5-13-11(7-10)8-15(20)18(13)2/h3-5,7,9H,1,6,8H2,2H3,(H,21,22) |
| InChIKey | UIGZKBZJSYDBNJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|