C13H11ClN2O2 — CID 84761196
3-(3-chlorophenyl)-1-prop-2-enylpyrazole-5-carboxylic acid (PubChem CID 84761196) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-prop-2-enylpyrazole-5-carboxylic acid.
| Compound Name | 3-(3-chlorophenyl)-1-prop-2-enylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 84761196 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-(3-chlorophenyl)-1-prop-2-enylpyrazole-5-carboxylic acid |
| SMILES | C=CCn1nc(-c2cccc(Cl)c2)cc1C(=O)O |
| InChI | InChI=1S/C13H11ClN2O2/c1-2-6-16-12(13(17)18)8-11(15-16)9-4-3-5-10(14)7-9/h2-5,7-8H,1,6H2,(H,17,18) |
| InChIKey | VDFCAMXKDOKEQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|