C12H11N5O — CID 82387510
5-(3-amino-1,2,4-triazin-5-yl)-1-methyl-3H-indol-2-one (PubChem CID 82387510) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-(3-amino-1,2,4-triazin-5-yl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(3-amino-1,2,4-triazin-5-yl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 82387510 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-(3-amino-1,2,4-triazin-5-yl)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(-c3cnnc(N)n3)ccc21 |
| InChI | InChI=1S/C12H11N5O/c1-17-10-3-2-7(4-8(10)5-11(17)18)9-6-14-16-12(13)15-9/h2-4,6H,5H2,1H3,(H2,13,15,16) |
| InChIKey | FUZAEVLUUVAPND-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |