C16H12N4OS — CID 60528907
1-methyl-5-(2-pyrazin-2-yl-1,3-thiazol-4-yl)-3H-indol-2-one (PubChem CID 60528907) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-methyl-5-(2-pyrazin-2-yl-1,3-thiazol-4-yl)-3H-indol-2-one.
| Compound Name | 1-methyl-5-(2-pyrazin-2-yl-1,3-thiazol-4-yl)-3H-indol-2-one |
|---|---|
| PubChem CID | 60528907 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-methyl-5-(2-pyrazin-2-yl-1,3-thiazol-4-yl)-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(-c3csc(-c4cnccn4)n3)ccc21 |
| InChI | InChI=1S/C16H12N4OS/c1-20-14-3-2-10(6-11(14)7-15(20)21)13-9-22-16(19-13)12-8-17-4-5-18-12/h2-6,8-9H,7H2,1H3 |
| InChIKey | LDMXLIWKCIIXRK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |