C14H13BrN2OS — CID 116970301
6-[2-(bromomethyl)-1,3-thiazol-4-yl]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 116970301) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is 6-[2-(bromomethyl)-1,3-thiazol-4-yl]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[2-(bromomethyl)-1,3-thiazol-4-yl]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 116970301 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 6-[2-(bromomethyl)-1,3-thiazol-4-yl]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(-c3csc(CBr)n3)ccc21 |
| InChI | InChI=1S/C14H13BrN2OS/c1-17-12-4-2-9(6-10(12)3-5-14(17)18)11-8-19-13(7-15)16-11/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | DXVVACXFNGXIBT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|