C13H11BrN2OS — CID 116887881
5-(5-bromo-4-methyl-1,3-thiazol-2-yl)-1-methyl-3H-indol-2-one (PubChem CID 116887881) has the molecular formula C13H11BrN2OS and a molecular weight of 323.22 g/mol. Its IUPAC name is 5-(5-bromo-4-methyl-1,3-thiazol-2-yl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(5-bromo-4-methyl-1,3-thiazol-2-yl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 116887881 |
| Molecular Formula | C13H11BrN2OS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 5-(5-bromo-4-methyl-1,3-thiazol-2-yl)-1-methyl-3H-indol-2-one |
| SMILES | Cc1nc(-c2ccc3c(c2)CC(=O)N3C)sc1Br |
| InChI | InChI=1S/C13H11BrN2OS/c1-7-12(14)18-13(15-7)8-3-4-10-9(5-8)6-11(17)16(10)2/h3-5H,6H2,1-2H3 |
| InChIKey | AEOCQGDRPQYBQV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |