2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid

C12H13NO4 — CID 117209716

IUPAC2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid
SMILESCN1C(=O)CCc2cccc(OCC(=O)O)c21
InChIInChI=1S/C12H13NO4/c1-13-10(14)6-5-8-3-2-4-9(12(8)13)17-7-11(15)16/h2-4H,5-7H2,1H3,(H,15,16)
InChIKeyFEOXIULFPOBQOO-UHFFFAOYSA-N
MW235.24 g/mol
LogP1.06
Rot. Bonds3

About 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid

2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid (PubChem CID 117209716) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid.

Molecular Properties

Compound Name2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid
PubChem CID117209716
Molecular FormulaC12H13NO4
Molecular Weight235.24 g/mol
Exact Mass235.08
IUPAC Name2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid
SMILESCN1C(=O)CCc2cccc(OCC(=O)O)c21
InChIInChI=1S/C12H13NO4/c1-13-10(14)6-5-8-3-2-4-9(12(8)13)17-7-11(15)16/h2-4H,5-7H2,1H3,(H,15,16)
InChIKeyFEOXIULFPOBQOO-UHFFFAOYSA-N
XLogP1.06
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid?
The IUPAC name of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid (CID 117209716) is 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid.
What is the SMILES notation for 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid?
The canonical SMILES for 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid is CN1C(=O)CCc2cccc(OCC(=O)O)c21.
What is the InChIKey of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid?
The InChIKey is FEOXIULFPOBQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-13-10(14)6-5-8-3-2-4-9(12(8)13)17-7-11(15)16/h2-4H,5-7H2,1H3,(H,15,16).
What are the key properties of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid?
2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid has a molecular weight of 235.24 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-8-yl)oxy]acetic acid is sourced from PubChem (CID 117209716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).