C15H17F3N4 — CID 117210172
1-[5-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-yl]piperazine (PubChem CID 117210172) has the molecular formula C15H17F3N4 and a molecular weight of 310.32 g/mol. Its IUPAC name is 1-[5-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-yl]piperazine.
| Compound Name | 1-[5-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-yl]piperazine |
|---|---|
| PubChem CID | 117210172 |
| Molecular Formula | C15H17F3N4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[5-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-4-yl]piperazine |
| SMILES | FC(F)(F)c1ccc(Cc2[nH]ncc2N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H17F3N4/c16-15(17,18)12-3-1-11(2-4-12)9-13-14(10-20-21-13)22-7-5-19-6-8-22/h1-4,10,19H,5-9H2,(H,20,21) |
| InChIKey | DABRQTQVMXINOL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |