C15H19F3N4 — CID 117210317
N'-[1-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propane-1,3-diamine (PubChem CID 117210317) has the molecular formula C15H19F3N4 and a molecular weight of 312.34 g/mol. Its IUPAC name is N'-[1-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propane-1,3-diamine.
| Compound Name | N'-[1-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117210317 |
| Molecular Formula | C15H19F3N4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N'-[1-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propane-1,3-diamine |
| SMILES | Cn1ncc(NCCCN)c1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N4/c1-22-14(13(10-21-22)20-7-3-6-19)9-11-4-2-5-12(8-11)15(16,17)18/h2,4-5,8,10,20H,3,6-7,9,19H2,1H3 |
| InChIKey | GZIWGUMSRWACON-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|