C15H22N4O — CID 117210740
N'-[5-ethyl-1-(3-methoxyphenyl)pyrazol-4-yl]propane-1,3-diamine (PubChem CID 117210740) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N'-[5-ethyl-1-(3-methoxyphenyl)pyrazol-4-yl]propane-1,3-diamine.
| Compound Name | N'-[5-ethyl-1-(3-methoxyphenyl)pyrazol-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117210740 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N'-[5-ethyl-1-(3-methoxyphenyl)pyrazol-4-yl]propane-1,3-diamine |
| SMILES | CCc1c(NCCCN)cnn1-c1cccc(OC)c1 |
| InChI | InChI=1S/C15H22N4O/c1-3-15-14(17-9-5-8-16)11-18-19(15)12-6-4-7-13(10-12)20-2/h4,6-7,10-11,17H,3,5,8-9,16H2,1-2H3 |
| InChIKey | LXHMLRYOIQYXOT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|