C17H24N4O — CID 117211775
N'-[4-(3-methoxyphenyl)-2-propan-2-ylpyrimidin-5-yl]propane-1,3-diamine (PubChem CID 117211775) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N'-[4-(3-methoxyphenyl)-2-propan-2-ylpyrimidin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[4-(3-methoxyphenyl)-2-propan-2-ylpyrimidin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117211775 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N'-[4-(3-methoxyphenyl)-2-propan-2-ylpyrimidin-5-yl]propane-1,3-diamine |
| SMILES | COc1cccc(-c2nc(C(C)C)ncc2NCCCN)c1 |
| InChI | InChI=1S/C17H24N4O/c1-12(2)17-20-11-15(19-9-5-8-18)16(21-17)13-6-4-7-14(10-13)22-3/h4,6-7,10-12,19H,5,8-9,18H2,1-3H3 |
| InChIKey | WLOBIDLBPVHYFK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|