C13H17N5O — CID 117211103
5-N-(2-aminoethyl)-4-(3-methoxyphenyl)pyrimidine-2,5-diamine (PubChem CID 117211103) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-N-(2-aminoethyl)-4-(3-methoxyphenyl)pyrimidine-2,5-diamine.
| Compound Name | 5-N-(2-aminoethyl)-4-(3-methoxyphenyl)pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 117211103 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 5-N-(2-aminoethyl)-4-(3-methoxyphenyl)pyrimidine-2,5-diamine |
| SMILES | COc1cccc(-c2nc(N)ncc2NCCN)c1 |
| InChI | InChI=1S/C13H17N5O/c1-19-10-4-2-3-9(7-10)12-11(16-6-5-14)8-17-13(15)18-12/h2-4,7-8,16H,5-6,14H2,1H3,(H2,15,17,18) |
| InChIKey | SDVYFGXQOUEVIX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |