C18H20N4 — CID 117210689
N'-[1-(3-methylphenyl)-5-phenylpyrazol-4-yl]ethane-1,2-diamine (PubChem CID 117210689) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is N'-[1-(3-methylphenyl)-5-phenylpyrazol-4-yl]ethane-1,2-diamine.
| Compound Name | N'-[1-(3-methylphenyl)-5-phenylpyrazol-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 117210689 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N'-[1-(3-methylphenyl)-5-phenylpyrazol-4-yl]ethane-1,2-diamine |
| SMILES | Cc1cccc(-n2ncc(NCCN)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H20N4/c1-14-6-5-9-16(12-14)22-18(15-7-3-2-4-8-15)17(13-21-22)20-11-10-19/h2-9,12-13,20H,10-11,19H2,1H3 |
| InChIKey | ITYBFNHRTRHFOJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |