C18H26N4 — CID 117212175
N'-[4-tert-butyl-2-(4-methylphenyl)pyrimidin-5-yl]propane-1,3-diamine (PubChem CID 117212175) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N'-[4-tert-butyl-2-(4-methylphenyl)pyrimidin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[4-tert-butyl-2-(4-methylphenyl)pyrimidin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117212175 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N'-[4-tert-butyl-2-(4-methylphenyl)pyrimidin-5-yl]propane-1,3-diamine |
| SMILES | Cc1ccc(-c2ncc(NCCCN)c(C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C18H26N4/c1-13-6-8-14(9-7-13)17-21-12-15(20-11-5-10-19)16(22-17)18(2,3)4/h6-9,12,20H,5,10-11,19H2,1-4H3 |
| InChIKey | VKAWVDBABNROOY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|