C6H9N3O3S — CID 117213601
(5-amino-1H-pyrazol-4-yl)-ethylsulfonylmethanone (PubChem CID 117213601) has the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. Its IUPAC name is (5-amino-1H-pyrazol-4-yl)-ethylsulfonylmethanone.
| Compound Name | (5-amino-1H-pyrazol-4-yl)-ethylsulfonylmethanone |
|---|---|
| PubChem CID | 117213601 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | (5-amino-1H-pyrazol-4-yl)-ethylsulfonylmethanone |
| SMILES | CCS(=O)(=O)C(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C6H9N3O3S/c1-2-13(11,12)6(10)4-3-8-9-5(4)7/h3H,2H2,1H3,(H3,7,8,9) |
| InChIKey | CMFBODAFTCMZKP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|