C30H34Cl3N5O2 — CID 11721363
5-chloro-6-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide (PubChem CID 11721363) has the molecular formula C30H34Cl3N5O2 and a molecular weight of 602.99 g/mol. Its IUPAC name is 5-chloro-6-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11721363 |
| Molecular Formula | C30H34Cl3N5O2 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 5-chloro-6-[4-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]piperazin-1-yl]-N-(2-phenoxyethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc(N2CCN(C3CCN(Cc4ccc(Cl)c(Cl)c4)CC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C30H34Cl3N5O2/c31-26-7-6-22(18-27(26)32)21-36-11-8-24(9-12-36)37-13-15-38(16-14-37)29-28(33)19-23(20-35-29)30(39)34-10-17-40-25-4-2-1-3-5-25/h1-7,18-20,24H,8-17,21H2,(H,34,39) |
| InChIKey | BAVLMVGOURBJTO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|