C36H40ClN5O2 — CID 59427442
5-chloro-N-(2-phenoxyethyl)-6-[4-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 59427442) has the molecular formula C36H40ClN5O2 and a molecular weight of 610.20 g/mol. Its IUPAC name is 5-chloro-N-(2-phenoxyethyl)-6-[4-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(2-phenoxyethyl)-6-[4-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59427442 |
| Molecular Formula | C36H40ClN5O2 |
| Molecular Weight | 610.20 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 5-chloro-N-(2-phenoxyethyl)-6-[4-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc(N2CCN(C3CCN(Cc4ccc(-c5ccccc5)cc4)CC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C36H40ClN5O2/c37-34-25-31(36(43)38-17-24-44-33-9-5-2-6-10-33)26-39-35(34)42-22-20-41(21-23-42)32-15-18-40(19-16-32)27-28-11-13-30(14-12-28)29-7-3-1-4-8-29/h1-14,25-26,32H,15-24,27H2,(H,38,43) |
| InChIKey | VGWGJTMYRWHFCC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.20 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|