C5H10N4S — CID 117214397
4-(ethylaminomethyl)thiadiazol-5-amine (PubChem CID 117214397) has the molecular formula C5H10N4S and a molecular weight of 158.23 g/mol. Its IUPAC name is 4-(ethylaminomethyl)thiadiazol-5-amine.
| Compound Name | 4-(ethylaminomethyl)thiadiazol-5-amine |
|---|---|
| PubChem CID | 117214397 |
| Molecular Formula | C5H10N4S |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4-(ethylaminomethyl)thiadiazol-5-amine |
| SMILES | CCNCc1nnsc1N |
| InChI | InChI=1S/C5H10N4S/c1-2-7-3-4-5(6)10-9-8-4/h7H,2-3,6H2,1H3 |
| InChIKey | QGSRYVUXKIPMMB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |