C8H11N3O3S — CID 117214542
5-(morpholin-4-ylmethyl)thiadiazole-4-carboxylic acid (PubChem CID 117214542) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 5-(morpholin-4-ylmethyl)thiadiazole-4-carboxylic acid.
| Compound Name | 5-(morpholin-4-ylmethyl)thiadiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117214542 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 5-(morpholin-4-ylmethyl)thiadiazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnsc1CN1CCOCC1 |
| InChI | InChI=1S/C8H11N3O3S/c12-8(13)7-6(15-10-9-7)5-11-1-3-14-4-2-11/h1-5H2,(H,12,13) |
| InChIKey | YGNJJFIVAQAWDC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |