C10H7FN2O3 — CID 117215010
(3-fluorophenyl) 5-amino-1,2-oxazole-3-carboxylate (PubChem CID 117215010) has the molecular formula C10H7FN2O3 and a molecular weight of 222.18 g/mol. Its IUPAC name is (3-fluorophenyl) 5-amino-1,2-oxazole-3-carboxylate.
| Compound Name | (3-fluorophenyl) 5-amino-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 117215010 |
| Molecular Formula | C10H7FN2O3 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (3-fluorophenyl) 5-amino-1,2-oxazole-3-carboxylate |
| SMILES | Nc1cc(C(=O)Oc2cccc(F)c2)no1 |
| InChI | InChI=1S/C10H7FN2O3/c11-6-2-1-3-7(4-6)15-10(14)8-5-9(12)16-13-8/h1-5H,12H2 |
| InChIKey | KJHDPRPFXVUZFN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|