C34H37Cl2F3N4O2 — CID 11721745
[(4S,5R)-2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazol-1-yl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 11721745) has the molecular formula C34H37Cl2F3N4O2 and a molecular weight of 661.60 g/mol. Its IUPAC name is [(4S,5R)-2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazol-1-yl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | [(4S,5R)-2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazol-1-yl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11721745 |
| Molecular Formula | C34H37Cl2F3N4O2 |
| Molecular Weight | 661.60 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | [(4S,5R)-2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazol-1-yl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cc(C(C)(C)C)ccc1C1=N[C@@H](c2ccc(Cl)cc2)[C@@H](c2ccc(Cl)cc2)N1C(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C34H37Cl2F3N4O2/c1-5-45-28-20-24(33(2,3)4)10-15-27(28)31-40-29(22-6-11-25(35)12-7-22)30(23-8-13-26(36)14-9-23)43(31)32(44)42-18-16-41(17-19-42)21-34(37,38)39/h6-15,20,29-30H,5,16-19,21H2,1-4H3/t29-,30+/m0/s1 |
| InChIKey | XHPOZONTYJPUEV-XZWHSSHBSA-N |
| XLogP | 8.53 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.60 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |