C37H40Cl2F3N5O4 — CID 11693477
[4-[(4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-1-yl]-morpholin-4-ylmethanone (PubChem CID 11693477) has the molecular formula C37H40Cl2F3N5O4 and a molecular weight of 746.66 g/mol. Its IUPAC name is [4-[(4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 11693477 |
| Molecular Formula | C37H40Cl2F3N5O4 |
| Molecular Weight | 746.66 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | [4-[(4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-1-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)(C)c1ccc(C2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N2C(=O)N2CCN(C(=O)N3CCOCC3)CC2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C37H40Cl2F3N5O4/c1-36(2,3)26-8-13-29(30(22-26)51-23-37(40,41)42)33-43-31(24-4-9-27(38)10-5-24)32(25-6-11-28(39)12-7-25)47(33)35(49)45-16-14-44(15-17-45)34(48)46-18-20-50-21-19-46/h4-13,22,31-32H,14-21,23H2,1-3H3/t31-,32+/m0/s1 |
| InChIKey | OYENQRPGMPBERN-AJQTZOPKSA-N |
| XLogP | 7.97 |
| TPSA | 77.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.66 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |