C28H24Cl3F3N2O2 — CID 86761342
(4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride (PubChem CID 86761342) has the molecular formula C28H24Cl3F3N2O2 and a molecular weight of 583.87 g/mol. Its IUPAC name is (4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride.
| Compound Name | (4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 86761342 |
| Molecular Formula | C28H24Cl3F3N2O2 |
| Molecular Weight | 583.87 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | (4S,5R)-2-[4-tert-butyl-2-(2,2,2-trifluoroethoxy)phenyl]-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
| SMILES | CC(C)(C)c1ccc(C2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N2C(=O)Cl)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C28H24Cl3F3N2O2/c1-27(2,3)18-8-13-21(22(14-18)38-15-28(32,33)34)25-35-23(16-4-9-19(29)10-5-16)24(36(25)26(31)37)17-6-11-20(30)12-7-17/h4-14,23-24H,15H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | IZZDMXXTMHESQX-BJKOFHAPSA-N |
| XLogP | 9.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.87 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|