C28H28Cl2N2O2 — CID 174981629
2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbaldehyde (PubChem CID 174981629) has the molecular formula C28H28Cl2N2O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbaldehyde.
| Compound Name | 2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbaldehyde |
|---|---|
| PubChem CID | 174981629 |
| Molecular Formula | C28H28Cl2N2O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-(4-tert-butyl-2-ethoxyphenyl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbaldehyde |
| SMILES | CCOc1cc(C(C)(C)C)ccc1C1=NC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1C=O |
| InChI | InChI=1S/C28H28Cl2N2O2/c1-5-34-24-16-20(28(2,3)4)10-15-23(24)27-31-25(18-6-11-21(29)12-7-18)26(32(27)17-33)19-8-13-22(30)14-9-19/h6-17,25-26H,5H2,1-4H3 |
| InChIKey | QFCAZZRIMKCNEX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|