C26H25Cl3N4O2 — CID 86613632
2-(2-tert-butyl-4-ethoxypyrimidin-5-yl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride (PubChem CID 86613632) has the molecular formula C26H25Cl3N4O2 and a molecular weight of 531.87 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-ethoxypyrimidin-5-yl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride.
| Compound Name | 2-(2-tert-butyl-4-ethoxypyrimidin-5-yl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
|---|---|
| PubChem CID | 86613632 |
| Molecular Formula | C26H25Cl3N4O2 |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-(2-tert-butyl-4-ethoxypyrimidin-5-yl)-4,5-bis(4-chlorophenyl)-4,5-dihydroimidazole-1-carbonyl chloride |
| SMILES | CCOc1nc(C(C)(C)C)ncc1C1=NC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1C(=O)Cl |
| InChI | InChI=1S/C26H25Cl3N4O2/c1-5-35-23-19(14-30-24(32-23)26(2,3)4)22-31-20(15-6-10-17(27)11-7-15)21(33(22)25(29)34)16-8-12-18(28)13-9-16/h6-14,20-21H,5H2,1-4H3 |
| InChIKey | LQXUEDWGQWCEHW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|