5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid

C7H10N2O4S — CID 117217573

IUPAC5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid
SMILESCCNCC1=C(C(=O)O)C=NS1(=O)=O
InChIInChI=1S/C7H10N2O4S/c1-2-8-4-6-5(7(10)11)3-9-14(6,12)13/h3,8H,2,4H2,1H3,(H,10,11)
InChIKeyZEXWJMAHMSDTHZ-UHFFFAOYSA-N
MW218.23 g/mol
LogP-0.65
Rot. Bonds4

About 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid

5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid (PubChem CID 117217573) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid
PubChem CID117217573
Molecular FormulaC7H10N2O4S
Molecular Weight218.23 g/mol
Exact Mass218.04
IUPAC Name5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid
SMILESCCNCC1=C(C(=O)O)C=NS1(=O)=O
InChIInChI=1S/C7H10N2O4S/c1-2-8-4-6-5(7(10)11)3-9-14(6,12)13/h3,8H,2,4H2,1H3,(H,10,11)
InChIKeyZEXWJMAHMSDTHZ-UHFFFAOYSA-N
XLogP-0.65
TPSA95.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.23
LogP ≤ 5-0.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid (CID 117217573) is 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid is CCNCC1=C(C(=O)O)C=NS1(=O)=O.
What is the InChIKey of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
The InChIKey is ZEXWJMAHMSDTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S/c1-2-8-4-6-5(7(10)11)3-9-14(6,12)13/h3,8H,2,4H2,1H3,(H,10,11).
What are the key properties of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid has a molecular weight of 218.23 g/mol, XLogP of -0.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 117217573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).