About 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid
5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid (PubChem CID 117217573) has the molecular formula C7H10N2O4S
and a molecular weight of 218.23 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid.
Analyze 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid (CID 117217573) is 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid is CCNCC1=C(C(=O)O)C=NS1(=O)=O.
What is the InChIKey of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
The InChIKey is ZEXWJMAHMSDTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S/c1-2-8-4-6-5(7(10)11)3-9-14(6,12)13/h3,8H,2,4H2,1H3,(H,10,11).
What are the key properties of 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid?
5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid has a molecular weight of 218.23 g/mol, XLogP of -0.65, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylaminomethyl)-1,1-dioxo-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 117217573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).