C9H9N3OS — CID 117217667
5-(pyridin-3-yloxymethyl)-1,2-thiazol-4-amine (PubChem CID 117217667) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 5-(pyridin-3-yloxymethyl)-1,2-thiazol-4-amine.
| Compound Name | 5-(pyridin-3-yloxymethyl)-1,2-thiazol-4-amine |
|---|---|
| PubChem CID | 117217667 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(pyridin-3-yloxymethyl)-1,2-thiazol-4-amine |
| SMILES | Nc1cnsc1COc1cccnc1 |
| InChI | InChI=1S/C9H9N3OS/c10-8-5-12-14-9(8)6-13-7-2-1-3-11-4-7/h1-5H,6,10H2 |
| InChIKey | IPBOFTLZYIUGRY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |