C9H9N3O3S — CID 117188137
1,1-dioxo-2-(pyridin-3-yloxymethyl)-1,3-thiazol-5-amine (PubChem CID 117188137) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is 1,1-dioxo-2-(pyridin-3-yloxymethyl)-1,3-thiazol-5-amine.
| Compound Name | 1,1-dioxo-2-(pyridin-3-yloxymethyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 117188137 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 1,1-dioxo-2-(pyridin-3-yloxymethyl)-1,3-thiazol-5-amine |
| SMILES | NC1=CN=C(COc2cccnc2)S1(=O)=O |
| InChI | InChI=1S/C9H9N3O3S/c10-8-5-12-9(16(8,13)14)6-15-7-2-1-3-11-4-7/h1-5H,6,10H2 |
| InChIKey | MLKGZTHASMNDMB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |