C13H21N3O2 — CID 117217894
5-(azepan-1-ylmethyl)-1-ethylpyrazole-4-carboxylic acid (PubChem CID 117217894) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(azepan-1-ylmethyl)-1-ethylpyrazole-4-carboxylic acid.
| Compound Name | 5-(azepan-1-ylmethyl)-1-ethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117217894 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 5-(azepan-1-ylmethyl)-1-ethylpyrazole-4-carboxylic acid |
| SMILES | CCn1ncc(C(=O)O)c1CN1CCCCCC1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-16-12(11(9-14-16)13(17)18)10-15-7-5-3-4-6-8-15/h9H,2-8,10H2,1H3,(H,17,18) |
| InChIKey | SROLSVWIYLHWQZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |