C9H14N2O2S — CID 117218023
1-ethyl-5-(ethylsulfanylmethyl)pyrazole-4-carboxylic acid (PubChem CID 117218023) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-ethyl-5-(ethylsulfanylmethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-ethyl-5-(ethylsulfanylmethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117218023 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-ethyl-5-(ethylsulfanylmethyl)pyrazole-4-carboxylic acid |
| SMILES | CCSCc1c(C(=O)O)cnn1CC |
| InChI | InChI=1S/C9H14N2O2S/c1-3-11-8(6-14-4-2)7(5-10-11)9(12)13/h5H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | PTGNBBMZKDZLOT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |