About ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate
ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate (PubChem CID 11722386) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate.
Molecular Properties
| Compound Name | ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate |
| PubChem CID | 11722386 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C1(CCCC1)C(=O)N2C(C)=O |
| InChI | InChI=1S/C17H19NO4/c1-3-22-15(20)12-6-7-14-13(10-12)17(8-4-5-9-17)16(21)18(14)11(2)19/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | LETXIEBQKHJSEV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate?
The IUPAC name of ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate (CID 11722386) is ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate.
What is the SMILES notation for ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate?
The canonical SMILES for ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate is CCOC(=O)c1ccc2c(c1)C1(CCCC1)C(=O)N2C(C)=O.
What is the InChIKey of ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate?
The InChIKey is LETXIEBQKHJSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4/c1-3-22-15(20)12-6-7-14-13(10-12)17(8-4-5-9-17)16(21)18(14)11(2)19/h6-7,10H,3-5,8-9H2,1-2H3.
What are the key properties of ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate?
ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate has a molecular weight of 301.34 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1'-acetyl-2'-oxospiro[cyclopentane-1,3'-indole]-5'-carboxylate is sourced from PubChem (CID 11722386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).