C13H15ClN4O — CID 117224550
N'-[5-(3-chlorophenoxy)pyrimidin-2-yl]propane-1,3-diamine (PubChem CID 117224550) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is N'-[5-(3-chlorophenoxy)pyrimidin-2-yl]propane-1,3-diamine.
| Compound Name | N'-[5-(3-chlorophenoxy)pyrimidin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117224550 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N'-[5-(3-chlorophenoxy)pyrimidin-2-yl]propane-1,3-diamine |
| SMILES | NCCCNc1ncc(Oc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C13H15ClN4O/c14-10-3-1-4-11(7-10)19-12-8-17-13(18-9-12)16-6-2-5-15/h1,3-4,7-9H,2,5-6,15H2,(H,16,17,18) |
| InChIKey | TZYDJFHHQDOIHV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|