About 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride
5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride (PubChem CID 117226888) has the molecular formula C14H19ClF3NO
and a molecular weight of 309.76 g/mol. Its IUPAC name is 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride |
| PubChem CID | 117226888 |
| Molecular Formula | C14H19ClF3NO |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride |
| SMILES | CC1(C)CNC(Cc2ccc(C(F)(F)F)cc2)OC1.Cl |
| InChI | InChI=1S/C14H18F3NO.ClH/c1-13(2)8-18-12(19-9-13)7-10-3-5-11(6-4-10)14(15,16)17;/h3-6,12,18H,7-9H2,1-2H3;1H |
| InChIKey | ASVOBKUUVWGBSM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride?
The IUPAC name of 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride (CID 117226888) is 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride.
What is the SMILES notation for 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride?
The canonical SMILES for 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride is CC1(C)CNC(Cc2ccc(C(F)(F)F)cc2)OC1.Cl.
What is the InChIKey of 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride?
The InChIKey is ASVOBKUUVWGBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3NO.ClH/c1-13(2)8-18-12(19-9-13)7-10-3-5-11(6-4-10)14(15,16)17;/h3-6,12,18H,7-9H2,1-2H3;1H.
What are the key properties of 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride?
5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride has a molecular weight of 309.76 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazinane;hydrochloride is sourced from PubChem (CID 117226888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).