About 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine
5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine (PubChem CID 117228982) has the molecular formula C13H16F3NO
and a molecular weight of 259.27 g/mol. Its IUPAC name is 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine |
| PubChem CID | 117228982 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine |
| SMILES | CC1(C)CNC(Cc2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C13H16F3NO/c1-12(2)8-17-11(18-12)7-9-4-3-5-10(6-9)13(14,15)16/h3-6,11,17H,7-8H2,1-2H3 |
| InChIKey | BTKZJLXCAIPCMS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine?
The IUPAC name of 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine (CID 117228982) is 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine.
What is the SMILES notation for 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine?
The canonical SMILES for 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine is CC1(C)CNC(Cc2cccc(C(F)(F)F)c2)O1.
What is the InChIKey of 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine?
The InChIKey is BTKZJLXCAIPCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO/c1-12(2)8-17-11(18-12)7-9-4-3-5-10(6-9)13(14,15)16/h3-6,11,17H,7-8H2,1-2H3.
What are the key properties of 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine?
5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine has a molecular weight of 259.27 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidine is sourced from PubChem (CID 117228982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).