C16H20F3N — CID 115927272
3-cyclopentyl-3-[[3-(trifluoromethyl)phenyl]methyl]azetidine (PubChem CID 115927272) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is 3-cyclopentyl-3-[[3-(trifluoromethyl)phenyl]methyl]azetidine.
| Compound Name | 3-cyclopentyl-3-[[3-(trifluoromethyl)phenyl]methyl]azetidine |
|---|---|
| PubChem CID | 115927272 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-cyclopentyl-3-[[3-(trifluoromethyl)phenyl]methyl]azetidine |
| SMILES | FC(F)(F)c1cccc(CC2(C3CCCC3)CNC2)c1 |
| InChI | InChI=1S/C16H20F3N/c17-16(18,19)14-7-3-4-12(8-14)9-15(10-20-11-15)13-5-1-2-6-13/h3-4,7-8,13,20H,1-2,5-6,9-11H2 |
| InChIKey | CELOKEKKAFBNCX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |