C20H23NO2 — CID 11722869
ethyl (2S,4R,5S)-4-benzyl-5-phenylpyrrolidine-2-carboxylate (PubChem CID 11722869) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is ethyl (2S,4R,5S)-4-benzyl-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4R,5S)-4-benzyl-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11722869 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl (2S,4R,5S)-4-benzyl-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](Cc2ccccc2)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C20H23NO2/c1-2-23-20(22)18-14-17(13-15-9-5-3-6-10-15)19(21-18)16-11-7-4-8-12-16/h3-12,17-19,21H,2,13-14H2,1H3/t17-,18+,19-/m1/s1 |
| InChIKey | BNSZPVCODNPCJZ-CEXWTWQISA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |