C11H22N2O — CID 117228935
5,5-dimethyl-2-(piperidin-3-ylmethyl)-1,3-oxazolidine (PubChem CID 117228935) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 5,5-dimethyl-2-(piperidin-3-ylmethyl)-1,3-oxazolidine.
| Compound Name | 5,5-dimethyl-2-(piperidin-3-ylmethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 117228935 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 5,5-dimethyl-2-(piperidin-3-ylmethyl)-1,3-oxazolidine |
| SMILES | CC1(C)CNC(CC2CCCNC2)O1 |
| InChI | InChI=1S/C11H22N2O/c1-11(2)8-13-10(14-11)6-9-4-3-5-12-7-9/h9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | ZLQPJOAQACFIFP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |