C13H19NO2 — CID 117229119
2-(2-methoxyphenyl)-2,5,5-trimethyl-1,3-oxazolidine (PubChem CID 117229119) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-2,5,5-trimethyl-1,3-oxazolidine.
| Compound Name | 2-(2-methoxyphenyl)-2,5,5-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 117229119 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-2,5,5-trimethyl-1,3-oxazolidine |
| SMILES | COc1ccccc1C1(C)NCC(C)(C)O1 |
| InChI | InChI=1S/C13H19NO2/c1-12(2)9-14-13(3,16-12)10-7-5-6-8-11(10)15-4/h5-8,14H,9H2,1-4H3 |
| InChIKey | RZAYBLWODHDSAV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |