C11H15N3O — CID 79510120
5-(2-methoxyphenyl)-5-methyl-1,4-dihydroimidazol-2-amine (PubChem CID 79510120) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-5-methyl-1,4-dihydroimidazol-2-amine.
| Compound Name | 5-(2-methoxyphenyl)-5-methyl-1,4-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79510120 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-(2-methoxyphenyl)-5-methyl-1,4-dihydroimidazol-2-amine |
| SMILES | COc1ccccc1C1(C)CN=C(N)N1 |
| InChI | InChI=1S/C11H15N3O/c1-11(7-13-10(12)14-11)8-5-3-4-6-9(8)15-2/h3-6H,7H2,1-2H3,(H3,12,13,14) |
| InChIKey | IYYXBNJEJLTYIU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |