About 5-chloro-1H-pyrazol-4-ol
5-chloro-1H-pyrazol-4-ol (PubChem CID 117232822) has the molecular formula C3H3ClN2O
and a molecular weight of 118.52 g/mol. Its IUPAC name is 5-chloro-1H-pyrazol-4-ol.
Molecular Properties
| Compound Name | 5-chloro-1H-pyrazol-4-ol |
| PubChem CID | 117232822 |
| Molecular Formula | C3H3ClN2O |
| Molecular Weight | 118.52 g/mol |
| Exact Mass | 117.99 |
| IUPAC Name | 5-chloro-1H-pyrazol-4-ol |
| SMILES | Oc1cn[nH]c1Cl |
| InChI | InChI=1S/C3H3ClN2O/c4-3-2(7)1-5-6-3/h1,7H,(H,5,6) |
| InChIKey | UDYUDWAFJHLUDF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.52 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1H-pyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1H-pyrazol-4-ol?
The IUPAC name of 5-chloro-1H-pyrazol-4-ol (CID 117232822) is 5-chloro-1H-pyrazol-4-ol.
What is the SMILES notation for 5-chloro-1H-pyrazol-4-ol?
The canonical SMILES for 5-chloro-1H-pyrazol-4-ol is Oc1cn[nH]c1Cl.
What is the InChIKey of 5-chloro-1H-pyrazol-4-ol?
The InChIKey is UDYUDWAFJHLUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClN2O/c4-3-2(7)1-5-6-3/h1,7H,(H,5,6).
What are the key properties of 5-chloro-1H-pyrazol-4-ol?
5-chloro-1H-pyrazol-4-ol has a molecular weight of 118.52 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1H-pyrazol-4-ol is sourced from PubChem (CID 117232822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).