About 5-trityl-1H-pyrazol-4-ol
5-trityl-1H-pyrazol-4-ol (PubChem CID 70097747) has the molecular formula C22H18N2O
and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-trityl-1H-pyrazol-4-ol.
Molecular Properties
| Compound Name | 5-trityl-1H-pyrazol-4-ol |
| PubChem CID | 70097747 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-trityl-1H-pyrazol-4-ol |
| SMILES | Oc1cn[nH]c1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O/c25-20-16-23-24-21(20)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16,25H,(H,23,24) |
| InChIKey | OYPSVRRLPGHNPC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-trityl-1H-pyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-trityl-1H-pyrazol-4-ol?
The IUPAC name of 5-trityl-1H-pyrazol-4-ol (CID 70097747) is 5-trityl-1H-pyrazol-4-ol.
What is the SMILES notation for 5-trityl-1H-pyrazol-4-ol?
The canonical SMILES for 5-trityl-1H-pyrazol-4-ol is Oc1cn[nH]c1C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-trityl-1H-pyrazol-4-ol?
The InChIKey is OYPSVRRLPGHNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O/c25-20-16-23-24-21(20)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16,25H,(H,23,24).
What are the key properties of 5-trityl-1H-pyrazol-4-ol?
5-trityl-1H-pyrazol-4-ol has a molecular weight of 326.40 g/mol, XLogP of 4.50, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-trityl-1H-pyrazol-4-ol is sourced from PubChem (CID 70097747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).